C19H28FN — CID 142103479
1-(cyclohexylmethyl)-3-[(4-fluorophenyl)methyl]piperidine (PubChem CID 142103479) has the molecular formula C19H28FN and a molecular weight of 289.44 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-3-[(4-fluorophenyl)methyl]piperidine.
| Compound Name | 1-(cyclohexylmethyl)-3-[(4-fluorophenyl)methyl]piperidine |
|---|---|
| PubChem CID | 142103479 |
| Molecular Formula | C19H28FN |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | 1-(cyclohexylmethyl)-3-[(4-fluorophenyl)methyl]piperidine |
| SMILES | Fc1ccc(CC2CCCN(CC3CCCCC3)C2)cc1 |
| InChI | InChI=1S/C19H28FN/c20-19-10-8-16(9-11-19)13-18-7-4-12-21(15-18)14-17-5-2-1-3-6-17/h8-11,17-18H,1-7,12-15H2 |
| InChIKey | ZBTICDQQLTWNDJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |