C22H35FN2O — CID 95402385
(3R)-3-[2-(4-fluorophenyl)ethyl]-1-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]piperidine (PubChem CID 95402385) has the molecular formula C22H35FN2O and a molecular weight of 362.53 g/mol. Its IUPAC name is (3R)-3-[2-(4-fluorophenyl)ethyl]-1-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]piperidine.
| Compound Name | (3R)-3-[2-(4-fluorophenyl)ethyl]-1-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]piperidine |
|---|---|
| PubChem CID | 95402385 |
| Molecular Formula | C22H35FN2O |
| Molecular Weight | 362.53 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | (3R)-3-[2-(4-fluorophenyl)ethyl]-1-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]piperidine |
| SMILES | COCCN1CCC(CN2CCC[C@@H](CCc3ccc(F)cc3)C2)CC1 |
| InChI | InChI=1S/C22H35FN2O/c1-26-16-15-24-13-10-21(11-14-24)18-25-12-2-3-20(17-25)5-4-19-6-8-22(23)9-7-19/h6-9,20-21H,2-5,10-18H2,1H3/t20-/m0/s1 |
| InChIKey | QALHWIYUSKRZBJ-FQEVSTJZSA-N |
| XLogP | 3.83 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |