About butane;cyclopentylmethylbenzene
butane;cyclopentylmethylbenzene (PubChem CID 143522605) has the molecular formula C16H26
and a molecular weight of 218.38 g/mol. Its IUPAC name is butane;cyclopentylmethylbenzene.
Molecular Properties
| Compound Name | butane;cyclopentylmethylbenzene |
| PubChem CID | 143522605 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | butane;cyclopentylmethylbenzene |
| SMILES | CCCC.c1ccc(CC2CCCC2)cc1 |
| InChI | InChI=1S/C12H16.C4H10/c1-2-6-11(7-3-1)10-12-8-4-5-9-12;1-3-4-2/h1-3,6-7,12H,4-5,8-10H2;3-4H2,1-2H3 |
| InChIKey | TVZDQGNCLLIKRP-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze butane;cyclopentylmethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;cyclopentylmethylbenzene?
The IUPAC name of butane;cyclopentylmethylbenzene (CID 143522605) is butane;cyclopentylmethylbenzene.
What is the SMILES notation for butane;cyclopentylmethylbenzene?
The canonical SMILES for butane;cyclopentylmethylbenzene is CCCC.c1ccc(CC2CCCC2)cc1.
What is the InChIKey of butane;cyclopentylmethylbenzene?
The InChIKey is TVZDQGNCLLIKRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16.C4H10/c1-2-6-11(7-3-1)10-12-8-4-5-9-12;1-3-4-2/h1-3,6-7,12H,4-5,8-10H2;3-4H2,1-2H3.
What are the key properties of butane;cyclopentylmethylbenzene?
butane;cyclopentylmethylbenzene has a molecular weight of 218.38 g/mol, XLogP of 5.23, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butane;cyclopentylmethylbenzene is sourced from PubChem (CID 143522605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).