About cyclopentylmethylbenzene;formamide
cyclopentylmethylbenzene;formamide (PubChem CID 174870384) has the molecular formula C13H19NO
and a molecular weight of 205.30 g/mol. Its IUPAC name is cyclopentylmethylbenzene;formamide.
Molecular Properties
| Compound Name | cyclopentylmethylbenzene;formamide |
| PubChem CID | 174870384 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | cyclopentylmethylbenzene;formamide |
| SMILES | NC=O.c1ccc(CC2CCCC2)cc1 |
| InChI | InChI=1S/C12H16.CH3NO/c1-2-6-11(7-3-1)10-12-8-4-5-9-12;2-1-3/h1-3,6-7,12H,4-5,8-10H2;1H,(H2,2,3) |
| InChIKey | XQYMAZZLULSVIS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze cyclopentylmethylbenzene;formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentylmethylbenzene;formamide?
The IUPAC name of cyclopentylmethylbenzene;formamide (CID 174870384) is cyclopentylmethylbenzene;formamide.
What is the SMILES notation for cyclopentylmethylbenzene;formamide?
The canonical SMILES for cyclopentylmethylbenzene;formamide is NC=O.c1ccc(CC2CCCC2)cc1.
What is the InChIKey of cyclopentylmethylbenzene;formamide?
The InChIKey is XQYMAZZLULSVIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16.CH3NO/c1-2-6-11(7-3-1)10-12-8-4-5-9-12;2-1-3/h1-3,6-7,12H,4-5,8-10H2;1H,(H2,2,3).
What are the key properties of cyclopentylmethylbenzene;formamide?
cyclopentylmethylbenzene;formamide has a molecular weight of 205.30 g/mol, XLogP of 2.52, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentylmethylbenzene;formamide is sourced from PubChem (CID 174870384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).