About 6-benzylcyclodecan-1-one
6-benzylcyclodecan-1-one (PubChem CID 22319830) has the molecular formula C17H24O
and a molecular weight of 244.38 g/mol. Its IUPAC name is 6-benzylcyclodecan-1-one.
Molecular Properties
| Compound Name | 6-benzylcyclodecan-1-one |
| PubChem CID | 22319830 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 6-benzylcyclodecan-1-one |
| SMILES | O=C1CCCCC(Cc2ccccc2)CCCC1 |
| InChI | InChI=1S/C17H24O/c18-17-12-6-4-10-16(11-5-7-13-17)14-15-8-2-1-3-9-15/h1-3,8-9,16H,4-7,10-14H2 |
| InChIKey | GKBWJKGJETXCJH-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-benzylcyclodecan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-benzylcyclodecan-1-one?
The IUPAC name of 6-benzylcyclodecan-1-one (CID 22319830) is 6-benzylcyclodecan-1-one.
What is the SMILES notation for 6-benzylcyclodecan-1-one?
The canonical SMILES for 6-benzylcyclodecan-1-one is O=C1CCCCC(Cc2ccccc2)CCCC1.
What is the InChIKey of 6-benzylcyclodecan-1-one?
The InChIKey is GKBWJKGJETXCJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O/c18-17-12-6-4-10-16(11-5-7-13-17)14-15-8-2-1-3-9-15/h1-3,8-9,16H,4-7,10-14H2.
What are the key properties of 6-benzylcyclodecan-1-one?
6-benzylcyclodecan-1-one has a molecular weight of 244.38 g/mol, XLogP of 4.55, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-benzylcyclodecan-1-one is sourced from PubChem (CID 22319830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).