C17H24O3 — CID 22319895
6-benzyl-2,3-dihydroxycyclodecan-1-one (PubChem CID 22319895) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is 6-benzyl-2,3-dihydroxycyclodecan-1-one.
| Compound Name | 6-benzyl-2,3-dihydroxycyclodecan-1-one |
|---|---|
| PubChem CID | 22319895 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 6-benzyl-2,3-dihydroxycyclodecan-1-one |
| SMILES | O=C1CCCCC(Cc2ccccc2)CCC(O)C1O |
| InChI | InChI=1S/C17H24O3/c18-15-9-5-4-8-14(10-11-16(19)17(15)20)12-13-6-2-1-3-7-13/h1-3,6-7,14,16-17,19-20H,4-5,8-12H2 |
| InChIKey | FCRNOEPRWRFMSI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |