C21H30 — CID 91363627
1-(cyclononylmethyl)-6-methylcyclodeca-1,3,5,7,9-pentaene (PubChem CID 91363627) has the molecular formula C21H30 and a molecular weight of 282.47 g/mol. Its IUPAC name is 1-(cyclononylmethyl)-6-methylcyclodeca-1,3,5,7,9-pentaene.
| Compound Name | 1-(cyclononylmethyl)-6-methylcyclodeca-1,3,5,7,9-pentaene |
|---|---|
| PubChem CID | 91363627 |
| Molecular Formula | C21H30 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 1-(cyclononylmethyl)-6-methylcyclodeca-1,3,5,7,9-pentaene |
| SMILES | Cc1ccccc(CC2CCCCCCCC2)cccc1 |
| InChI | InChI=1S/C21H30/c1-19-12-8-10-16-21(17-11-9-13-19)18-20-14-6-4-2-3-5-7-15-20/h8-13,16-17,20H,2-7,14-15,18H2,1H3/b10-8+,11-9+,12-8-,13-9+,16-10+,17-11-,19-12-,19-13-,21-16+,21-17+ |
| InChIKey | ZJOGZZBAMHXQJN-GFSDSWGQSA-N |
| XLogP | 6.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |