About 5-benzyldiazepane
5-benzyldiazepane (PubChem CID 154443129) has the molecular formula C12H18N2
and a molecular weight of 190.29 g/mol. Its IUPAC name is 5-benzyldiazepane.
Molecular Properties
| Compound Name | 5-benzyldiazepane |
| PubChem CID | 154443129 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 5-benzyldiazepane |
| SMILES | c1ccc(CC2CCNNCC2)cc1 |
| InChI | InChI=1S/C12H18N2/c1-2-4-11(5-3-1)10-12-6-8-13-14-9-7-12/h1-5,12-14H,6-10H2 |
| InChIKey | HLPRFPFAEYMJRK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-benzyldiazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyldiazepane?
The IUPAC name of 5-benzyldiazepane (CID 154443129) is 5-benzyldiazepane.
What is the SMILES notation for 5-benzyldiazepane?
The canonical SMILES for 5-benzyldiazepane is c1ccc(CC2CCNNCC2)cc1.
What is the InChIKey of 5-benzyldiazepane?
The InChIKey is HLPRFPFAEYMJRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2/c1-2-4-11(5-3-1)10-12-6-8-13-14-9-7-12/h1-5,12-14H,6-10H2.
What are the key properties of 5-benzyldiazepane?
5-benzyldiazepane has a molecular weight of 190.29 g/mol, XLogP of 1.73, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyldiazepane is sourced from PubChem (CID 154443129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).