C19H23N — CID 101092769
(2R,4R)-2,4-dibenzylpiperidine (PubChem CID 101092769) has the molecular formula C19H23N and a molecular weight of 265.40 g/mol. Its IUPAC name is (2R,4R)-2,4-dibenzylpiperidine.
| Compound Name | (2R,4R)-2,4-dibenzylpiperidine |
|---|---|
| PubChem CID | 101092769 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | (2R,4R)-2,4-dibenzylpiperidine |
| SMILES | c1ccc(C[C@@H]2CCN[C@@H](Cc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C19H23N/c1-3-7-16(8-4-1)13-18-11-12-20-19(15-18)14-17-9-5-2-6-10-17/h1-10,18-20H,11-15H2/t18-,19-/m0/s1 |
| InChIKey | BFONOKLTSYGSQJ-OALUTQOASA-N |
| XLogP | 3.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |