C20H25N3O — CID 22966123
1-[[(2S,4R)-4-benzylpiperidin-2-yl]methyl]-3-phenylurea (PubChem CID 22966123) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is 1-[[(2S,4R)-4-benzylpiperidin-2-yl]methyl]-3-phenylurea.
| Compound Name | 1-[[(2S,4R)-4-benzylpiperidin-2-yl]methyl]-3-phenylurea |
|---|---|
| PubChem CID | 22966123 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 1-[[(2S,4R)-4-benzylpiperidin-2-yl]methyl]-3-phenylurea |
| SMILES | O=C(NC[C@@H]1C[C@H](Cc2ccccc2)CCN1)Nc1ccccc1 |
| InChI | InChI=1S/C20H25N3O/c24-20(23-18-9-5-2-6-10-18)22-15-19-14-17(11-12-21-19)13-16-7-3-1-4-8-16/h1-10,17,19,21H,11-15H2,(H2,22,23,24)/t17-,19-/m0/s1 |
| InChIKey | YIVXSBPGHFKPNJ-HKUYNNGSSA-N |
| XLogP | 3.42 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |