C25H33N3O3 — CID 154428702
ethyl 3-[3-[(2S,4R)-4-benzylpiperidin-2-yl]propylcarbamoylamino]benzoate (PubChem CID 154428702) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is ethyl 3-[3-[(2S,4R)-4-benzylpiperidin-2-yl]propylcarbamoylamino]benzoate.
| Compound Name | ethyl 3-[3-[(2S,4R)-4-benzylpiperidin-2-yl]propylcarbamoylamino]benzoate |
|---|---|
| PubChem CID | 154428702 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | ethyl 3-[3-[(2S,4R)-4-benzylpiperidin-2-yl]propylcarbamoylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)NCCC[C@H]2C[C@H](Cc3ccccc3)CCN2)c1 |
| InChI | InChI=1S/C25H33N3O3/c1-2-31-24(29)21-10-6-11-23(18-21)28-25(30)27-14-7-12-22-17-20(13-15-26-22)16-19-8-4-3-5-9-19/h3-6,8-11,18,20,22,26H,2,7,12-17H2,1H3,(H2,27,28,30)/t20-,22-/m0/s1 |
| InChIKey | QIXHSEDOLLZPTE-UNMCSNQZSA-N |
| XLogP | 4.38 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|