C23H29N3O3 — CID 22966133
ethyl 3-[[(2S,5S)-5-benzylpiperidin-2-yl]methylcarbamoylamino]benzoate (PubChem CID 22966133) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is ethyl 3-[[(2S,5S)-5-benzylpiperidin-2-yl]methylcarbamoylamino]benzoate.
| Compound Name | ethyl 3-[[(2S,5S)-5-benzylpiperidin-2-yl]methylcarbamoylamino]benzoate |
|---|---|
| PubChem CID | 22966133 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | ethyl 3-[[(2S,5S)-5-benzylpiperidin-2-yl]methylcarbamoylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)NC[C@@H]2CC[C@@H](Cc3ccccc3)CN2)c1 |
| InChI | InChI=1S/C23H29N3O3/c1-2-29-22(27)19-9-6-10-20(14-19)26-23(28)25-16-21-12-11-18(15-24-21)13-17-7-4-3-5-8-17/h3-10,14,18,21,24H,2,11-13,15-16H2,1H3,(H2,25,26,28)/t18-,21-/m0/s1 |
| InChIKey | JORIVTIUEPNGBW-RXVVDRJESA-N |
| XLogP | 3.60 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |