C14H20ClN3O3 — CID 154900818
methyl 3-[[(2S)-pyrrolidin-2-yl]methylcarbamoylamino]benzoate;hydrochloride (PubChem CID 154900818) has the molecular formula C14H20ClN3O3 and a molecular weight of 313.79 g/mol. Its IUPAC name is methyl 3-[[(2S)-pyrrolidin-2-yl]methylcarbamoylamino]benzoate;hydrochloride.
| Compound Name | methyl 3-[[(2S)-pyrrolidin-2-yl]methylcarbamoylamino]benzoate;hydrochloride |
|---|---|
| PubChem CID | 154900818 |
| Molecular Formula | C14H20ClN3O3 |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | methyl 3-[[(2S)-pyrrolidin-2-yl]methylcarbamoylamino]benzoate;hydrochloride |
| SMILES | COC(=O)c1cccc(NC(=O)NC[C@@H]2CCCN2)c1.Cl |
| InChI | InChI=1S/C14H19N3O3.ClH/c1-20-13(18)10-4-2-5-11(8-10)17-14(19)16-9-12-6-3-7-15-12;/h2,4-5,8,12,15H,3,6-7,9H2,1H3,(H2,16,17,19);1H/t12-;/m0./s1 |
| InChIKey | ITFJUTGMIHWUAA-YDALLXLXSA-N |
| XLogP | 1.77 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |