C12H17N3O2 — CID 117235796
1-(4-hydroxyphenyl)-3-(pyrrolidin-2-ylmethyl)urea (PubChem CID 117235796) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 1-(4-hydroxyphenyl)-3-(pyrrolidin-2-ylmethyl)urea.
| Compound Name | 1-(4-hydroxyphenyl)-3-(pyrrolidin-2-ylmethyl)urea |
|---|---|
| PubChem CID | 117235796 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 1-(4-hydroxyphenyl)-3-(pyrrolidin-2-ylmethyl)urea |
| SMILES | O=C(NCC1CCCN1)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C12H17N3O2/c16-11-5-3-9(4-6-11)15-12(17)14-8-10-2-1-7-13-10/h3-6,10,13,16H,1-2,7-8H2,(H2,14,15,17) |
| InChIKey | IRYSACYILUEBHQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|