C13H19N3O2 — CID 106637935
methyl N-[3-(pyrrolidin-2-ylmethylamino)phenyl]carbamate (PubChem CID 106637935) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is methyl N-[3-(pyrrolidin-2-ylmethylamino)phenyl]carbamate.
| Compound Name | methyl N-[3-(pyrrolidin-2-ylmethylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 106637935 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | methyl N-[3-(pyrrolidin-2-ylmethylamino)phenyl]carbamate |
| SMILES | COC(=O)Nc1cccc(NCC2CCCN2)c1 |
| InChI | InChI=1S/C13H19N3O2/c1-18-13(17)16-11-5-2-4-10(8-11)15-9-12-6-3-7-14-12/h2,4-5,8,12,14-15H,3,6-7,9H2,1H3,(H,16,17) |
| InChIKey | PRMDHHNDQXBIKL-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |