C19H22N2O8 — CID 17389955
oxalic acid;N-(pyrrolidin-2-ylmethyl)naphthalen-2-amine (PubChem CID 17389955) has the molecular formula C19H22N2O8 and a molecular weight of 406.39 g/mol. Its IUPAC name is oxalic acid;N-(pyrrolidin-2-ylmethyl)naphthalen-2-amine.
| Compound Name | oxalic acid;N-(pyrrolidin-2-ylmethyl)naphthalen-2-amine |
|---|---|
| PubChem CID | 17389955 |
| Molecular Formula | C19H22N2O8 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | oxalic acid;N-(pyrrolidin-2-ylmethyl)naphthalen-2-amine |
| SMILES | O=C(O)C(=O)O.O=C(O)C(=O)O.c1ccc2cc(NCC3CCCN3)ccc2c1 |
| InChI | InChI=1S/C15H18N2.2C2H2O4/c1-2-5-13-10-14(8-7-12(13)4-1)17-11-15-6-3-9-16-15;2*3-1(4)2(5)6/h1-2,4-5,7-8,10,15-17H,3,6,9,11H2;2*(H,3,4)(H,5,6) |
| InChIKey | NMOKGSAYYIRCGV-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 173.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|