3,4-dichloro-N-(pyrrolidin-2-ylmethyl)aniline;oxalic acid

C15H18Cl2N2O8 — CID 17389918

IUPAC3,4-dichloro-N-(pyrrolidin-2-ylmethyl)aniline;oxalic acid
SMILESClc1ccc(NCC2CCCN2)cc1Cl.O=C(O)C(=O)O.O=C(O)C(=O)O
InChIInChI=1S/C11H14Cl2N2.2C2H2O4/c12-10-4-3-8(6-11(10)13)15-7-9-2-1-5-14-9;2*3-1(4)2(5)6/h3-4,6,9,14-15H,1-2,5,7H2;2*(H,3,4)(H,5,6)
InChIKeyYSWIOAKOIULJNC-UHFFFAOYSA-N
MW425.22 g/mol
LogP1.47
Rot. Bonds3

About 3,4-dichloro-N-(pyrrolidin-2-ylmethyl)aniline;oxalic acid

3,4-dichloro-N-(pyrrolidin-2-ylmethyl)aniline;oxalic acid (PubChem CID 17389918) has the molecular formula C15H18Cl2N2O8 and a molecular weight of 425.22 g/mol. Its IUPAC name is 3,4-dichloro-N-(pyrrolidin-2-ylmethyl)aniline;oxalic acid.

Molecular Properties

Compound Name3,4-dichloro-N-(pyrrolidin-2-ylmethyl)aniline;oxalic acid
PubChem CID17389918
Molecular FormulaC15H18Cl2N2O8
Molecular Weight425.22 g/mol
Exact Mass424.04
IUPAC Name3,4-dichloro-N-(pyrrolidin-2-ylmethyl)aniline;oxalic acid
SMILESClc1ccc(NCC2CCCN2)cc1Cl.O=C(O)C(=O)O.O=C(O)C(=O)O
InChIInChI=1S/C11H14Cl2N2.2C2H2O4/c12-10-4-3-8(6-11(10)13)15-7-9-2-1-5-14-9;2*3-1(4)2(5)6/h3-4,6,9,14-15H,1-2,5,7H2;2*(H,3,4)(H,5,6)
InChIKeyYSWIOAKOIULJNC-UHFFFAOYSA-N
XLogP1.47
TPSA173.26 Ų
H-Bond Donors6
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms27
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500425.22
LogP ≤ 51.47
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 3,4-dichloro-N-(pyrrolidin-2-ylmethyl)aniline;oxalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,4-dichloro-N-(pyrrolidin-2-ylmethyl)aniline;oxalic acid?
The IUPAC name of 3,4-dichloro-N-(pyrrolidin-2-ylmethyl)aniline;oxalic acid (CID 17389918) is 3,4-dichloro-N-(pyrrolidin-2-ylmethyl)aniline;oxalic acid.
What is the SMILES notation for 3,4-dichloro-N-(pyrrolidin-2-ylmethyl)aniline;oxalic acid?
The canonical SMILES for 3,4-dichloro-N-(pyrrolidin-2-ylmethyl)aniline;oxalic acid is Clc1ccc(NCC2CCCN2)cc1Cl.O=C(O)C(=O)O.O=C(O)C(=O)O.
What is the InChIKey of 3,4-dichloro-N-(pyrrolidin-2-ylmethyl)aniline;oxalic acid?
The InChIKey is YSWIOAKOIULJNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14Cl2N2.2C2H2O4/c12-10-4-3-8(6-11(10)13)15-7-9-2-1-5-14-9;2*3-1(4)2(5)6/h3-4,6,9,14-15H,1-2,5,7H2;2*(H,3,4)(H,5,6).
What are the key properties of 3,4-dichloro-N-(pyrrolidin-2-ylmethyl)aniline;oxalic acid?
3,4-dichloro-N-(pyrrolidin-2-ylmethyl)aniline;oxalic acid has a molecular weight of 425.22 g/mol, XLogP of 1.47, 3 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dichloro-N-(pyrrolidin-2-ylmethyl)aniline;oxalic acid is sourced from PubChem (CID 17389918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).