C15H18Cl2N2O8 — CID 17389918
3,4-dichloro-N-(pyrrolidin-2-ylmethyl)aniline;oxalic acid (PubChem CID 17389918) has the molecular formula C15H18Cl2N2O8 and a molecular weight of 425.22 g/mol. Its IUPAC name is 3,4-dichloro-N-(pyrrolidin-2-ylmethyl)aniline;oxalic acid.
| Compound Name | 3,4-dichloro-N-(pyrrolidin-2-ylmethyl)aniline;oxalic acid |
|---|---|
| PubChem CID | 17389918 |
| Molecular Formula | C15H18Cl2N2O8 |
| Molecular Weight | 425.22 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | 3,4-dichloro-N-(pyrrolidin-2-ylmethyl)aniline;oxalic acid |
| SMILES | Clc1ccc(NCC2CCCN2)cc1Cl.O=C(O)C(=O)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C11H14Cl2N2.2C2H2O4/c12-10-4-3-8(6-11(10)13)15-7-9-2-1-5-14-9;2*3-1(4)2(5)6/h3-4,6,9,14-15H,1-2,5,7H2;2*(H,3,4)(H,5,6) |
| InChIKey | YSWIOAKOIULJNC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 173.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.22 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|