C14H19Cl2N3O3 — CID 154908582
1-[(3,4-dichlorophenyl)methyl]-3-[[(2S)-pyrrolidin-2-yl]methyl]urea;formic acid (PubChem CID 154908582) has the molecular formula C14H19Cl2N3O3 and a molecular weight of 348.23 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-3-[[(2S)-pyrrolidin-2-yl]methyl]urea;formic acid.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-3-[[(2S)-pyrrolidin-2-yl]methyl]urea;formic acid |
|---|---|
| PubChem CID | 154908582 |
| Molecular Formula | C14H19Cl2N3O3 |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-3-[[(2S)-pyrrolidin-2-yl]methyl]urea;formic acid |
| SMILES | O=C(NCc1ccc(Cl)c(Cl)c1)NC[C@@H]1CCCN1.O=CO |
| InChI | InChI=1S/C13H17Cl2N3O.CH2O2/c14-11-4-3-9(6-12(11)15)7-17-13(19)18-8-10-2-1-5-16-10;2-1-3/h3-4,6,10,16H,1-2,5,7-8H2,(H2,17,18,19);1H,(H,2,3)/t10-;/m0./s1 |
| InChIKey | BJCCPGPSAIZMMJ-PPHPATTJSA-N |
| XLogP | 2.25 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|