C13H16Cl2N2O — CID 63045287
2-(3,4-dichlorophenyl)-N-(pyrrolidin-2-ylmethyl)acetamide (PubChem CID 63045287) has the molecular formula C13H16Cl2N2O and a molecular weight of 287.19 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-(pyrrolidin-2-ylmethyl)acetamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-(pyrrolidin-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 63045287 |
| Molecular Formula | C13H16Cl2N2O |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-(pyrrolidin-2-ylmethyl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)c(Cl)c1)NCC1CCCN1 |
| InChI | InChI=1S/C13H16Cl2N2O/c14-11-4-3-9(6-12(11)15)7-13(18)17-8-10-2-1-5-16-10/h3-4,6,10,16H,1-2,5,7-8H2,(H,17,18) |
| InChIKey | POWLNJZUAHVCNZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |