C25H29N3O — CID 163231585
2-methyl-N-[(1R)-1-naphthalen-1-ylethyl]-5-[[(2S)-pyrrolidin-2-yl]methylamino]benzamide (PubChem CID 163231585) has the molecular formula C25H29N3O and a molecular weight of 387.53 g/mol. Its IUPAC name is 2-methyl-N-[(1R)-1-naphthalen-1-ylethyl]-5-[[(2S)-pyrrolidin-2-yl]methylamino]benzamide.
| Compound Name | 2-methyl-N-[(1R)-1-naphthalen-1-ylethyl]-5-[[(2S)-pyrrolidin-2-yl]methylamino]benzamide |
|---|---|
| PubChem CID | 163231585 |
| Molecular Formula | C25H29N3O |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 2-methyl-N-[(1R)-1-naphthalen-1-ylethyl]-5-[[(2S)-pyrrolidin-2-yl]methylamino]benzamide |
| SMILES | Cc1ccc(NC[C@@H]2CCCN2)cc1C(=O)N[C@H](C)c1cccc2ccccc12 |
| InChI | InChI=1S/C25H29N3O/c1-17-12-13-20(27-16-21-9-6-14-26-21)15-24(17)25(29)28-18(2)22-11-5-8-19-7-3-4-10-23(19)22/h3-5,7-8,10-13,15,18,21,26-27H,6,9,14,16H2,1-2H3,(H,28,29)/t18-,21+/m1/s1 |
| InChIKey | BEQZYWMAYHHPTI-NQIIRXRSSA-N |
| XLogP | 4.80 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |