C26H23NO — CID 165115788
2-methyl-N-[(1R)-1-naphthalen-1-ylethyl]-5-phenylbenzamide (PubChem CID 165115788) has the molecular formula C26H23NO and a molecular weight of 365.48 g/mol. Its IUPAC name is 2-methyl-N-[(1R)-1-naphthalen-1-ylethyl]-5-phenylbenzamide.
| Compound Name | 2-methyl-N-[(1R)-1-naphthalen-1-ylethyl]-5-phenylbenzamide |
|---|---|
| PubChem CID | 165115788 |
| Molecular Formula | C26H23NO |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 2-methyl-N-[(1R)-1-naphthalen-1-ylethyl]-5-phenylbenzamide |
| SMILES | Cc1ccc(-c2ccccc2)cc1C(=O)N[C@H](C)c1cccc2ccccc12 |
| InChI | InChI=1S/C26H23NO/c1-18-15-16-22(20-9-4-3-5-10-20)17-25(18)26(28)27-19(2)23-14-8-12-21-11-6-7-13-24(21)23/h3-17,19H,1-2H3,(H,27,28)/t19-/m1/s1 |
| InChIKey | NBEIKLMXISADNR-LJQANCHMSA-N |
| XLogP | 6.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |