C26H30BNO3 — CID 165116052
2-methyl-N-[(1R)-1-naphthalen-1-ylethyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (PubChem CID 165116052) has the molecular formula C26H30BNO3 and a molecular weight of 415.34 g/mol. Its IUPAC name is 2-methyl-N-[(1R)-1-naphthalen-1-ylethyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide.
| Compound Name | 2-methyl-N-[(1R)-1-naphthalen-1-ylethyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
|---|---|
| PubChem CID | 165116052 |
| Molecular Formula | C26H30BNO3 |
| Molecular Weight | 415.34 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 2-methyl-N-[(1R)-1-naphthalen-1-ylethyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| SMILES | Cc1ccc(B2OC(C)(C)C(C)(C)O2)cc1C(=O)N[C@H](C)c1cccc2ccccc12 |
| InChI | InChI=1S/C26H30BNO3/c1-17-14-15-20(27-30-25(3,4)26(5,6)31-27)16-23(17)24(29)28-18(2)21-13-9-11-19-10-7-8-12-22(19)21/h7-16,18H,1-6H3,(H,28,29)/t18-/m1/s1 |
| InChIKey | SKAFPABCVMXAMY-GOSISDBHSA-N |
| XLogP | 4.94 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.34 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|