C24H27N3O2 — CID 163231625
5-(4-aminobutanoylamino)-2-methyl-N-[(1R)-1-naphthalen-1-ylethyl]benzamide (PubChem CID 163231625) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 5-(4-aminobutanoylamino)-2-methyl-N-[(1R)-1-naphthalen-1-ylethyl]benzamide.
| Compound Name | 5-(4-aminobutanoylamino)-2-methyl-N-[(1R)-1-naphthalen-1-ylethyl]benzamide |
|---|---|
| PubChem CID | 163231625 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 5-(4-aminobutanoylamino)-2-methyl-N-[(1R)-1-naphthalen-1-ylethyl]benzamide |
| SMILES | Cc1ccc(NC(=O)CCCN)cc1C(=O)N[C@H](C)c1cccc2ccccc12 |
| InChI | InChI=1S/C24H27N3O2/c1-16-12-13-19(27-23(28)11-6-14-25)15-22(16)24(29)26-17(2)20-10-5-8-18-7-3-4-9-21(18)20/h3-5,7-10,12-13,15,17H,6,11,14,25H2,1-2H3,(H,26,29)(H,27,28)/t17-/m1/s1 |
| InChIKey | QBVXQOBOTZAMBJ-QGZVFWFLSA-N |
| XLogP | 4.32 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |