C28H27N3O2 — CID 163231845
5-(benzylcarbamoylamino)-2-methyl-N-[(1R)-1-naphthalen-1-ylethyl]benzamide (PubChem CID 163231845) has the molecular formula C28H27N3O2 and a molecular weight of 437.54 g/mol. Its IUPAC name is 5-(benzylcarbamoylamino)-2-methyl-N-[(1R)-1-naphthalen-1-ylethyl]benzamide.
| Compound Name | 5-(benzylcarbamoylamino)-2-methyl-N-[(1R)-1-naphthalen-1-ylethyl]benzamide |
|---|---|
| PubChem CID | 163231845 |
| Molecular Formula | C28H27N3O2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 5-(benzylcarbamoylamino)-2-methyl-N-[(1R)-1-naphthalen-1-ylethyl]benzamide |
| SMILES | Cc1ccc(NC(=O)NCc2ccccc2)cc1C(=O)N[C@H](C)c1cccc2ccccc12 |
| InChI | InChI=1S/C28H27N3O2/c1-19-15-16-23(31-28(33)29-18-21-9-4-3-5-10-21)17-26(19)27(32)30-20(2)24-14-8-12-22-11-6-7-13-25(22)24/h3-17,20H,18H2,1-2H3,(H,30,32)(H2,29,31,33)/t20-/m1/s1 |
| InChIKey | AGCLPBIMUUZZMJ-HXUWFJFHSA-N |
| XLogP | 5.96 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |