C16H20N2O2 — CID 60942839
methyl N-[3-(2-bicyclo[2.2.1]hept-5-enylmethylamino)phenyl]carbamate (PubChem CID 60942839) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is methyl N-[3-(2-bicyclo[2.2.1]hept-5-enylmethylamino)phenyl]carbamate.
| Compound Name | methyl N-[3-(2-bicyclo[2.2.1]hept-5-enylmethylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 60942839 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | methyl N-[3-(2-bicyclo[2.2.1]hept-5-enylmethylamino)phenyl]carbamate |
| SMILES | COC(=O)Nc1cccc(NCC2CC3C=CC2C3)c1 |
| InChI | InChI=1S/C16H20N2O2/c1-20-16(19)18-15-4-2-3-14(9-15)17-10-13-8-11-5-6-12(13)7-11/h2-6,9,11-13,17H,7-8,10H2,1H3,(H,18,19) |
| InChIKey | WIWJAFTZGQCNLV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|