C19H26N2O2 — CID 107240495
tert-butyl N-[4-(2-bicyclo[2.2.1]hept-5-enylmethylamino)phenyl]carbamate (PubChem CID 107240495) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is tert-butyl N-[4-(2-bicyclo[2.2.1]hept-5-enylmethylamino)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-(2-bicyclo[2.2.1]hept-5-enylmethylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 107240495 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | tert-butyl N-[4-(2-bicyclo[2.2.1]hept-5-enylmethylamino)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(NCC2CC3C=CC2C3)cc1 |
| InChI | InChI=1S/C19H26N2O2/c1-19(2,3)23-18(22)21-17-8-6-16(7-9-17)20-12-15-11-13-4-5-14(15)10-13/h4-9,13-15,20H,10-12H2,1-3H3,(H,21,22) |
| InChIKey | MNYQJCZRIDHFRA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|