C19H32N2O2 — CID 104956449
tert-butyl 4-(2-bicyclo[2.2.1]hept-5-enylmethylamino)-4-methylpiperidine-1-carboxylate (PubChem CID 104956449) has the molecular formula C19H32N2O2 and a molecular weight of 320.48 g/mol. Its IUPAC name is tert-butyl 4-(2-bicyclo[2.2.1]hept-5-enylmethylamino)-4-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-bicyclo[2.2.1]hept-5-enylmethylamino)-4-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 104956449 |
| Molecular Formula | C19H32N2O2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | tert-butyl 4-(2-bicyclo[2.2.1]hept-5-enylmethylamino)-4-methylpiperidine-1-carboxylate |
| SMILES | CC1(NCC2CC3C=CC2C3)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H32N2O2/c1-18(2,3)23-17(22)21-9-7-19(4,8-10-21)20-13-16-12-14-5-6-15(16)11-14/h5-6,14-16,20H,7-13H2,1-4H3 |
| InChIKey | LLDXSENHZQDBMY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|