C14H24N2O — CID 103824427
3-(2-bicyclo[2.2.1]hept-5-enylmethylamino)-N,2,2-trimethylpropanamide (PubChem CID 103824427) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is 3-(2-bicyclo[2.2.1]hept-5-enylmethylamino)-N,2,2-trimethylpropanamide.
| Compound Name | 3-(2-bicyclo[2.2.1]hept-5-enylmethylamino)-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 103824427 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 3-(2-bicyclo[2.2.1]hept-5-enylmethylamino)-N,2,2-trimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)CNCC1CC2C=CC1C2 |
| InChI | InChI=1S/C14H24N2O/c1-14(2,13(17)15-3)9-16-8-12-7-10-4-5-11(12)6-10/h4-5,10-12,16H,6-9H2,1-3H3,(H,15,17) |
| InChIKey | MGFNQYDLFQSDMS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|