C10H15NO — CID 130645148
N-[[(2R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]acetamide (PubChem CID 130645148) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is N-[[(2R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]acetamide.
| Compound Name | N-[[(2R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]acetamide |
|---|---|
| PubChem CID | 130645148 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | N-[[(2R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]acetamide |
| SMILES | CC(=O)NC[C@@H]1CC2C=CC1C2 |
| InChI | InChI=1S/C10H15NO/c1-7(12)11-6-10-5-8-2-3-9(10)4-8/h2-3,8-10H,4-6H2,1H3,(H,11,12)/t8?,9?,10-/m0/s1 |
| InChIKey | RSQJHBHGQMRDHX-RTBKNWGFSA-N |
| XLogP | 1.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|