C11H18N2O — CID 24847532
3-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1,1-dimethylurea (PubChem CID 24847532) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 3-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1,1-dimethylurea.
| Compound Name | 3-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1,1-dimethylurea |
|---|---|
| PubChem CID | 24847532 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 3-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCC1CC2C=CC1C2 |
| InChI | InChI=1S/C11H18N2O/c1-13(2)11(14)12-7-10-6-8-3-4-9(10)5-8/h3-4,8-10H,5-7H2,1-2H3,(H,12,14) |
| InChIKey | KOXMIRQCGGFTLM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|