C18H24N2O — CID 98236513
2-[2-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylamino]phenyl]-N,N-dimethylacetamide (PubChem CID 98236513) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-[2-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylamino]phenyl]-N,N-dimethylacetamide.
| Compound Name | 2-[2-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylamino]phenyl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 98236513 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 2-[2-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylamino]phenyl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)Cc1ccccc1NC[C@@H]1C[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C18H24N2O/c1-20(2)18(21)11-15-5-3-4-6-17(15)19-12-16-10-13-7-8-14(16)9-13/h3-8,13-14,16,19H,9-12H2,1-2H3/t13-,14-,16-/m0/s1 |
| InChIKey | ZBMQMMUECRUZNE-DZKIICNBSA-N |
| XLogP | 2.94 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|