C14H21N3O2 — CID 47377414
N,N-dimethyl-2-[2-(propan-2-ylcarbamoylamino)phenyl]acetamide (PubChem CID 47377414) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is N,N-dimethyl-2-[2-(propan-2-ylcarbamoylamino)phenyl]acetamide.
| Compound Name | N,N-dimethyl-2-[2-(propan-2-ylcarbamoylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 47377414 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | N,N-dimethyl-2-[2-(propan-2-ylcarbamoylamino)phenyl]acetamide |
| SMILES | CC(C)NC(=O)Nc1ccccc1CC(=O)N(C)C |
| InChI | InChI=1S/C14H21N3O2/c1-10(2)15-14(19)16-12-8-6-5-7-11(12)9-13(18)17(3)4/h5-8,10H,9H2,1-4H3,(H2,15,16,19) |
| InChIKey | BSDZNZWLMCIDKY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |