C17H27N3O2 — CID 60577078
2-[2-(hexylcarbamoylamino)phenyl]-N,N-dimethylacetamide (PubChem CID 60577078) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is 2-[2-(hexylcarbamoylamino)phenyl]-N,N-dimethylacetamide.
| Compound Name | 2-[2-(hexylcarbamoylamino)phenyl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 60577078 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 2-[2-(hexylcarbamoylamino)phenyl]-N,N-dimethylacetamide |
| SMILES | CCCCCCNC(=O)Nc1ccccc1CC(=O)N(C)C |
| InChI | InChI=1S/C17H27N3O2/c1-4-5-6-9-12-18-17(22)19-15-11-8-7-10-14(15)13-16(21)20(2)3/h7-8,10-11H,4-6,9,12-13H2,1-3H3,(H2,18,19,22) |
| InChIKey | ZTPFBRUXAXVYQD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|