C16H21NO2 — CID 43758056
N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2,4-dimethoxyaniline (PubChem CID 43758056) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2,4-dimethoxyaniline.
| Compound Name | N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2,4-dimethoxyaniline |
|---|---|
| PubChem CID | 43758056 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2,4-dimethoxyaniline |
| SMILES | COc1ccc(NCC2CC3C=CC2C3)c(OC)c1 |
| InChI | InChI=1S/C16H21NO2/c1-18-14-5-6-15(16(9-14)19-2)17-10-13-8-11-3-4-12(13)7-11/h3-6,9,11-13,17H,7-8,10H2,1-2H3 |
| InChIKey | FJXXYGLLDVSYDZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|