C16H19FN2O2 — CID 118767553
1-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-3-(2-fluoro-4-methoxyphenyl)urea (PubChem CID 118767553) has the molecular formula C16H19FN2O2 and a molecular weight of 290.34 g/mol. Its IUPAC name is 1-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-3-(2-fluoro-4-methoxyphenyl)urea.
| Compound Name | 1-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-3-(2-fluoro-4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 118767553 |
| Molecular Formula | C16H19FN2O2 |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 1-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-3-(2-fluoro-4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)NC[C@@H]2C[C@@H]3C=C[C@H]2C3)c(F)c1 |
| InChI | InChI=1S/C16H19FN2O2/c1-21-13-4-5-15(14(17)8-13)19-16(20)18-9-12-7-10-2-3-11(12)6-10/h2-5,8,10-12H,6-7,9H2,1H3,(H2,18,19,20)/t10-,11+,12+/m1/s1 |
| InChIKey | MMMRNMDGYQWFJF-WOPDTQHZSA-N |
| XLogP | 3.17 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|