C18H22N2O4 — CID 118785133
methyl 3-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methylcarbamoylamino]-4-methoxybenzoate (PubChem CID 118785133) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is methyl 3-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methylcarbamoylamino]-4-methoxybenzoate.
| Compound Name | methyl 3-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methylcarbamoylamino]-4-methoxybenzoate |
|---|---|
| PubChem CID | 118785133 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | methyl 3-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methylcarbamoylamino]-4-methoxybenzoate |
| SMILES | COC(=O)c1ccc(OC)c(NC(=O)NC[C@@H]2C[C@@H]3C=C[C@H]2C3)c1 |
| InChI | InChI=1S/C18H22N2O4/c1-23-16-6-5-13(17(21)24-2)9-15(16)20-18(22)19-10-14-8-11-3-4-12(14)7-11/h3-6,9,11-12,14H,7-8,10H2,1-2H3,(H2,19,20,22)/t11-,12+,14+/m1/s1 |
| InChIKey | IDRIEWAXVQLENP-DYEKYZERSA-N |
| XLogP | 2.82 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|