C22H31N3O3 — CID 98259941
3-[[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl-propan-2-ylcarbamoyl]amino]-4-methoxy-N,N-dimethylbenzamide (PubChem CID 98259941) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is 3-[[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl-propan-2-ylcarbamoyl]amino]-4-methoxy-N,N-dimethylbenzamide.
| Compound Name | 3-[[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl-propan-2-ylcarbamoyl]amino]-4-methoxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 98259941 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | 3-[[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl-propan-2-ylcarbamoyl]amino]-4-methoxy-N,N-dimethylbenzamide |
| SMILES | COc1ccc(C(=O)N(C)C)cc1NC(=O)N(C[C@H]1C[C@H]2C=C[C@H]1C2)C(C)C |
| InChI | InChI=1S/C22H31N3O3/c1-14(2)25(13-18-11-15-6-7-16(18)10-15)22(27)23-19-12-17(21(26)24(3)4)8-9-20(19)28-5/h6-9,12,14-16,18H,10-11,13H2,1-5H3,(H,23,27)/t15-,16-,18+/m0/s1 |
| InChIKey | QKFPVYOVLKNZNC-XYJFISCASA-N |
| XLogP | 3.85 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|