C16H19NO — CID 98819419
N-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-methylbenzamide (PubChem CID 98819419) has the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. Its IUPAC name is N-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-methylbenzamide.
| Compound Name | N-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 98819419 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | N-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC[C@H]2C[C@H]3C=C[C@H]2C3)cc1 |
| InChI | InChI=1S/C16H19NO/c1-11-2-5-13(6-3-11)16(18)17-10-15-9-12-4-7-14(15)8-12/h2-7,12,14-15H,8-10H2,1H3,(H,17,18)/t12-,14-,15+/m0/s1 |
| InChIKey | LCZBWGGEEJAQJN-AEGPPILISA-N |
| XLogP | 2.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|