C19H23N5O — CID 98886141
N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-(2-propan-2-yltetrazol-5-yl)benzamide (PubChem CID 98886141) has the molecular formula C19H23N5O and a molecular weight of 337.43 g/mol. Its IUPAC name is N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-(2-propan-2-yltetrazol-5-yl)benzamide.
| Compound Name | N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-(2-propan-2-yltetrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 98886141 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-(2-propan-2-yltetrazol-5-yl)benzamide |
| SMILES | CC(C)n1nnc(-c2ccc(C(=O)NC[C@@H]3C[C@H]4C=C[C@H]3C4)cc2)n1 |
| InChI | InChI=1S/C19H23N5O/c1-12(2)24-22-18(21-23-24)14-5-7-15(8-6-14)19(25)20-11-17-10-13-3-4-16(17)9-13/h3-8,12-13,16-17H,9-11H2,1-2H3,(H,20,25)/t13-,16-,17-/m0/s1 |
| InChIKey | YLNKPCJDSSYAKV-JQFCIGGWSA-N |
| XLogP | 2.86 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|