C17H19N5O — CID 99731800
N-[[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-methyl-3-(tetrazol-1-yl)benzamide (PubChem CID 99731800) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is N-[[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-methyl-3-(tetrazol-1-yl)benzamide.
| Compound Name | N-[[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-methyl-3-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 99731800 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | N-[[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-methyl-3-(tetrazol-1-yl)benzamide |
| SMILES | Cc1ccc(C(=O)NC[C@H]2C[C@H]3C=C[C@@H]2C3)cc1-n1cnnn1 |
| InChI | InChI=1S/C17H19N5O/c1-11-2-4-14(8-16(11)22-10-19-20-21-22)17(23)18-9-15-7-12-3-5-13(15)6-12/h2-5,8,10,12-13,15H,6-7,9H2,1H3,(H,18,23)/t12-,13+,15+/m0/s1 |
| InChIKey | CQLOFQNDBXWBMH-GZBFAFLISA-N |
| XLogP | 1.91 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|