C20H22N2O — CID 70719625
N-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2,8-dimethylquinoline-4-carboxamide (PubChem CID 70719625) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is N-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2,8-dimethylquinoline-4-carboxamide.
| Compound Name | N-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2,8-dimethylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 70719625 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | N-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2,8-dimethylquinoline-4-carboxamide |
| SMILES | Cc1cc(C(=O)NC[C@@H]2C[C@@H]3C=C[C@H]2C3)c2cccc(C)c2n1 |
| InChI | InChI=1S/C20H22N2O/c1-12-4-3-5-17-18(8-13(2)22-19(12)17)20(23)21-11-16-10-14-6-7-15(16)9-14/h3-8,14-16H,9-11H2,1-2H3,(H,21,23)/t14-,15+,16+/m1/s1 |
| InChIKey | GUCCTVKIYRYWQU-PMPSAXMXSA-N |
| XLogP | 3.79 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|