C18H20N2O — CID 51721297
N-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-1-methylindole-4-carboxamide (PubChem CID 51721297) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is N-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-1-methylindole-4-carboxamide.
| Compound Name | N-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-1-methylindole-4-carboxamide |
|---|---|
| PubChem CID | 51721297 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | N-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-1-methylindole-4-carboxamide |
| SMILES | Cn1ccc2c(C(=O)NC[C@H]3C[C@@H]4C=C[C@H]3C4)cccc21 |
| InChI | InChI=1S/C18H20N2O/c1-20-8-7-15-16(3-2-4-17(15)20)18(21)19-11-14-10-12-5-6-13(14)9-12/h2-8,12-14H,9-11H2,1H3,(H,19,21)/t12-,13+,14-/m1/s1 |
| InChIKey | NMRZIXUNKGHCDF-HZSPNIEDSA-N |
| XLogP | 3.12 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|