C16H18N2O3 — CID 51972824
N-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-N'-(3-hydroxyphenyl)oxamide (PubChem CID 51972824) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is N-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-N'-(3-hydroxyphenyl)oxamide.
| Compound Name | N-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-N'-(3-hydroxyphenyl)oxamide |
|---|---|
| PubChem CID | 51972824 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | N-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-N'-(3-hydroxyphenyl)oxamide |
| SMILES | O=C(NC[C@H]1C[C@@H]2C=C[C@H]1C2)C(=O)Nc1cccc(O)c1 |
| InChI | InChI=1S/C16H18N2O3/c19-14-3-1-2-13(8-14)18-16(21)15(20)17-9-12-7-10-4-5-11(12)6-10/h1-5,8,10-12,19H,6-7,9H2,(H,17,20)(H,18,21)/t10-,11+,12-/m1/s1 |
| InChIKey | BRHNMPFMJFHIKT-GRYCIOLGSA-N |
| XLogP | 1.66 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|