C21H22N4O3 — CID 98229550
N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-N'-[4-(1-methylimidazole-2-carbonyl)phenyl]oxamide (PubChem CID 98229550) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-N'-[4-(1-methylimidazole-2-carbonyl)phenyl]oxamide.
| Compound Name | N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-N'-[4-(1-methylimidazole-2-carbonyl)phenyl]oxamide |
|---|---|
| PubChem CID | 98229550 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-N'-[4-(1-methylimidazole-2-carbonyl)phenyl]oxamide |
| SMILES | Cn1ccnc1C(=O)c1ccc(NC(=O)C(=O)NC[C@@H]2C[C@H]3C=C[C@H]2C3)cc1 |
| InChI | InChI=1S/C21H22N4O3/c1-25-9-8-22-19(25)18(26)14-4-6-17(7-5-14)24-21(28)20(27)23-12-16-11-13-2-3-15(16)10-13/h2-9,13,15-16H,10-12H2,1H3,(H,23,27)(H,24,28)/t13-,15-,16-/m0/s1 |
| InChIKey | JLFZMKBYWZSLFR-BPUTZDHNSA-N |
| XLogP | 1.92 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|