C21H22N4O3 — CID 51044200
N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-N'-[3-(1-methylimidazole-2-carbonyl)phenyl]oxamide (PubChem CID 51044200) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-N'-[3-(1-methylimidazole-2-carbonyl)phenyl]oxamide.
| Compound Name | N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-N'-[3-(1-methylimidazole-2-carbonyl)phenyl]oxamide |
|---|---|
| PubChem CID | 51044200 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-N'-[3-(1-methylimidazole-2-carbonyl)phenyl]oxamide |
| SMILES | Cn1ccnc1C(=O)c1cccc(NC(=O)C(=O)NCC2CC3C=CC2C3)c1 |
| InChI | InChI=1S/C21H22N4O3/c1-25-8-7-22-19(25)18(26)15-3-2-4-17(11-15)24-21(28)20(27)23-12-16-10-13-5-6-14(16)9-13/h2-8,11,13-14,16H,9-10,12H2,1H3,(H,23,27)(H,24,28) |
| InChIKey | YLJADOKIJLVVNI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|