C22H26N4O4 — CID 124845973
3-[(4R)-1-(3-acetamidophenyl)-2,5-dioxoimidazolidin-4-yl]-N-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]propanamide (PubChem CID 124845973) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is 3-[(4R)-1-(3-acetamidophenyl)-2,5-dioxoimidazolidin-4-yl]-N-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]propanamide.
| Compound Name | 3-[(4R)-1-(3-acetamidophenyl)-2,5-dioxoimidazolidin-4-yl]-N-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]propanamide |
|---|---|
| PubChem CID | 124845973 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 3-[(4R)-1-(3-acetamidophenyl)-2,5-dioxoimidazolidin-4-yl]-N-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]propanamide |
| SMILES | CC(=O)Nc1cccc(N2C(=O)N[C@H](CCC(=O)NC[C@H]3C[C@H]4C=C[C@H]3C4)C2=O)c1 |
| InChI | InChI=1S/C22H26N4O4/c1-13(27)24-17-3-2-4-18(11-17)26-21(29)19(25-22(26)30)7-8-20(28)23-12-16-10-14-5-6-15(16)9-14/h2-6,11,14-16,19H,7-10,12H2,1H3,(H,23,28)(H,24,27)(H,25,30)/t14-,15-,16+,19+/m0/s1 |
| InChIKey | HYXNEBRGPSMSQC-YIOZNXECSA-N |
| XLogP | 2.18 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|