C23H30N4O5 — CID 110206841
N-[3-[(4S)-4-[3-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-3-oxopropyl]-2,5-dioxoimidazolidin-1-yl]phenyl]acetamide (PubChem CID 110206841) has the molecular formula C23H30N4O5 and a molecular weight of 442.52 g/mol. Its IUPAC name is N-[3-[(4S)-4-[3-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-3-oxopropyl]-2,5-dioxoimidazolidin-1-yl]phenyl]acetamide.
| Compound Name | N-[3-[(4S)-4-[3-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-3-oxopropyl]-2,5-dioxoimidazolidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 110206841 |
| Molecular Formula | C23H30N4O5 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | N-[3-[(4S)-4-[3-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-3-oxopropyl]-2,5-dioxoimidazolidin-1-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(N2C(=O)N[C@@H](CCC(=O)N3CCC4(O)CCCCC4C3)C2=O)c1 |
| InChI | InChI=1S/C23H30N4O5/c1-15(28)24-17-6-4-7-18(13-17)27-21(30)19(25-22(27)31)8-9-20(29)26-12-11-23(32)10-3-2-5-16(23)14-26/h4,6-7,13,16,19,32H,2-3,5,8-12,14H2,1H3,(H,24,28)(H,25,31)/t16?,19-,23?/m0/s1 |
| InChIKey | MWMRVBXNWRUXSA-DWVUQKNYSA-N |
| XLogP | 2.00 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|