C21H34N2O2 — CID 125427639
1-[(4aR,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-6-(2,5-dimethylpyrrol-1-yl)hexan-1-one (PubChem CID 125427639) has the molecular formula C21H34N2O2 and a molecular weight of 346.51 g/mol. Its IUPAC name is 1-[(4aR,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-6-(2,5-dimethylpyrrol-1-yl)hexan-1-one.
| Compound Name | 1-[(4aR,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-6-(2,5-dimethylpyrrol-1-yl)hexan-1-one |
|---|---|
| PubChem CID | 125427639 |
| Molecular Formula | C21H34N2O2 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | 1-[(4aR,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-6-(2,5-dimethylpyrrol-1-yl)hexan-1-one |
| SMILES | Cc1ccc(C)n1CCCCCC(=O)N1CC[C@]2(O)CCCC[C@H]2C1 |
| InChI | InChI=1S/C21H34N2O2/c1-17-10-11-18(2)23(17)14-7-3-4-9-20(24)22-15-13-21(25)12-6-5-8-19(21)16-22/h10-11,19,25H,3-9,12-16H2,1-2H3/t19-,21+/m0/s1 |
| InChIKey | HRBKYOZMLGNQLB-PZJWPPBQSA-N |
| XLogP | 3.82 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|