C15H23NO3 — CID 109479358
1-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-3-prop-2-ynoxypropan-1-one (PubChem CID 109479358) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 1-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-3-prop-2-ynoxypropan-1-one.
| Compound Name | 1-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-3-prop-2-ynoxypropan-1-one |
|---|---|
| PubChem CID | 109479358 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 1-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-3-prop-2-ynoxypropan-1-one |
| SMILES | C#CCOCCC(=O)N1CCC2(O)CCCCC2C1 |
| InChI | InChI=1S/C15H23NO3/c1-2-10-19-11-6-14(17)16-9-8-15(18)7-4-3-5-13(15)12-16/h1,13,18H,3-12H2 |
| InChIKey | WBQHXVVZPSLISV-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|