C22H28N2O2 — CID 124875602
(3R)-1-[(4aR,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-phenyl-3-pyrrol-1-ylpropan-1-one (PubChem CID 124875602) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is (3R)-1-[(4aR,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-phenyl-3-pyrrol-1-ylpropan-1-one.
| Compound Name | (3R)-1-[(4aR,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-phenyl-3-pyrrol-1-ylpropan-1-one |
|---|---|
| PubChem CID | 124875602 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | (3R)-1-[(4aR,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-phenyl-3-pyrrol-1-ylpropan-1-one |
| SMILES | O=C(C[C@H](c1ccccc1)n1cccc1)N1CC[C@]2(O)CCCC[C@@H]2C1 |
| InChI | InChI=1S/C22H28N2O2/c25-21(24-15-12-22(26)11-5-4-10-19(22)17-24)16-20(23-13-6-7-14-23)18-8-2-1-3-9-18/h1-3,6-9,13-14,19-20,26H,4-5,10-12,15-17H2/t19-,20-,22-/m1/s1 |
| InChIKey | CIRLRFKYLFRXDQ-KCZVDYSFSA-N |
| XLogP | 3.62 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |